C11H14ClF2NOS — CID 28622690
3-chloro-4-(difluoromethoxy)-N-(3-methylsulfanylpropyl)aniline (PubChem CID 28622690) has the molecular formula C11H14ClF2NOS and a molecular weight of 281.75 g/mol. Its IUPAC name is 3-chloro-4-(difluoromethoxy)-N-(3-methylsulfanylpropyl)aniline.
| Compound Name | 3-chloro-4-(difluoromethoxy)-N-(3-methylsulfanylpropyl)aniline |
|---|---|
| PubChem CID | 28622690 |
| Molecular Formula | C11H14ClF2NOS |
| Molecular Weight | 281.75 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 3-chloro-4-(difluoromethoxy)-N-(3-methylsulfanylpropyl)aniline |
| SMILES | CSCCCNc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C11H14ClF2NOS/c1-17-6-2-5-15-8-3-4-10(9(12)7-8)16-11(13)14/h3-4,7,11,15H,2,5-6H2,1H3 |
| InChIKey | ZGQIWCYXDICJJI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.75 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|