C23H31NO4 — CID 28631512
(2R)-N-[3-(4-ethoxy-3-methoxyphenyl)propyl]-2-(3-methylphenoxy)butanamide (PubChem CID 28631512) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is (2R)-N-[3-(4-ethoxy-3-methoxyphenyl)propyl]-2-(3-methylphenoxy)butanamide.
| Compound Name | (2R)-N-[3-(4-ethoxy-3-methoxyphenyl)propyl]-2-(3-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 28631512 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | (2R)-N-[3-(4-ethoxy-3-methoxyphenyl)propyl]-2-(3-methylphenoxy)butanamide |
| SMILES | CCOc1ccc(CCCNC(=O)[C@@H](CC)Oc2cccc(C)c2)cc1OC |
| InChI | InChI=1S/C23H31NO4/c1-5-20(28-19-11-7-9-17(3)15-19)23(25)24-14-8-10-18-12-13-21(27-6-2)22(16-18)26-4/h7,9,11-13,15-16,20H,5-6,8,10,14H2,1-4H3,(H,24,25)/t20-/m1/s1 |
| InChIKey | FVDMUMAEMDENDV-HXUWFJFHSA-N |
| XLogP | 4.31 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|