C27H20Cl3NO — CID 2865294
1-[4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-3-(2,3-dichlorophenyl)prop-2-en-1-one (PubChem CID 2865294) has the molecular formula C27H20Cl3NO and a molecular weight of 480.82 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-3-(2,3-dichlorophenyl)prop-2-en-1-one.
| Compound Name | 1-[4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-3-(2,3-dichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 2865294 |
| Molecular Formula | C27H20Cl3NO |
| Molecular Weight | 480.82 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 1-[4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-3-(2,3-dichlorophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1cccc(Cl)c1Cl)c1ccc2c(c1)C1C=CCC1C(c1ccc(Cl)cc1)N2 |
| InChI | InChI=1S/C27H20Cl3NO/c28-19-11-7-17(8-12-19)27-21-5-2-4-20(21)22-15-18(9-13-24(22)31-27)25(32)14-10-16-3-1-6-23(29)26(16)30/h1-4,6-15,20-21,27,31H,5H2 |
| InChIKey | HTYLLRXUMGOQFV-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.82 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|