C13H20N2O2S — CID 28660363
(2R)-N-tert-butyl-2-methyl-2,3-dihydro-1H-indole-5-sulfonamide (PubChem CID 28660363) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is (2R)-N-tert-butyl-2-methyl-2,3-dihydro-1H-indole-5-sulfonamide.
| Compound Name | (2R)-N-tert-butyl-2-methyl-2,3-dihydro-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 28660363 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (2R)-N-tert-butyl-2-methyl-2,3-dihydro-1H-indole-5-sulfonamide |
| SMILES | C[C@@H]1Cc2cc(S(=O)(=O)NC(C)(C)C)ccc2N1 |
| InChI | InChI=1S/C13H20N2O2S/c1-9-7-10-8-11(5-6-12(10)14-9)18(16,17)15-13(2,3)4/h5-6,8-9,14-15H,7H2,1-4H3/t9-/m1/s1 |
| InChIKey | FQGODOCFSNQSLS-SECBINFHSA-N |
| XLogP | 2.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |