C18H18BrNO5 — CID 28676599
5-[[2-(2-bromo-4,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-3-methylbenzoic acid (PubChem CID 28676599) has the molecular formula C18H18BrNO5 and a molecular weight of 408.25 g/mol. Its IUPAC name is 5-[[2-(2-bromo-4,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-3-methylbenzoic acid.
| Compound Name | 5-[[2-(2-bromo-4,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-3-methylbenzoic acid |
|---|---|
| PubChem CID | 28676599 |
| Molecular Formula | C18H18BrNO5 |
| Molecular Weight | 408.25 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 5-[[2-(2-bromo-4,6-dimethylphenoxy)acetyl]amino]-2-hydroxy-3-methylbenzoic acid |
| SMILES | Cc1cc(C)c(OCC(=O)Nc2cc(C)c(O)c(C(=O)O)c2)c(Br)c1 |
| InChI | InChI=1S/C18H18BrNO5/c1-9-4-11(3)17(14(19)5-9)25-8-15(21)20-12-6-10(2)16(22)13(7-12)18(23)24/h4-7,22H,8H2,1-3H3,(H,20,21)(H,23,24) |
| InChIKey | KQIDTVFLFMARCP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.25 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|