C13H16N4O2S — CID 28689486
6-[(2S)-2-methylpiperidin-1-yl]-5-nitro-1,3-benzothiazol-2-amine (PubChem CID 28689486) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 6-[(2S)-2-methylpiperidin-1-yl]-5-nitro-1,3-benzothiazol-2-amine.
| Compound Name | 6-[(2S)-2-methylpiperidin-1-yl]-5-nitro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 28689486 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 6-[(2S)-2-methylpiperidin-1-yl]-5-nitro-1,3-benzothiazol-2-amine |
| SMILES | C[C@H]1CCCCN1c1cc2sc(N)nc2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N4O2S/c1-8-4-2-3-5-16(8)10-7-12-9(15-13(14)20-12)6-11(10)17(18)19/h6-8H,2-5H2,1H3,(H2,14,15)/t8-/m0/s1 |
| InChIKey | CFBXOHRXVNMKKC-QMMMGPOBSA-N |
| XLogP | 3.17 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|