C17H16BrN3OS — CID 28691048
[5-(7-bromo-5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]thiourea (PubChem CID 28691048) has the molecular formula C17H16BrN3OS and a molecular weight of 390.31 g/mol. Its IUPAC name is [5-(7-bromo-5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]thiourea.
| Compound Name | [5-(7-bromo-5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]thiourea |
|---|---|
| PubChem CID | 28691048 |
| Molecular Formula | C17H16BrN3OS |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | [5-(7-bromo-5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]thiourea |
| SMILES | Cc1ccc(-c2nc3cc(C)c(C)c(Br)c3o2)cc1NC(N)=S |
| InChI | InChI=1S/C17H16BrN3OS/c1-8-4-5-11(7-12(8)21-17(19)23)16-20-13-6-9(2)10(3)14(18)15(13)22-16/h4-7H,1-3H3,(H3,19,21,23) |
| InChIKey | WVXLORLNDJDUES-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|