C20H24N2O2S — CID 28692570
6-ethyl-2-methyl-3-[4-(2-methylphenoxy)butyl]thieno[2,3-d]pyrimidin-4-one (PubChem CID 28692570) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is 6-ethyl-2-methyl-3-[4-(2-methylphenoxy)butyl]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 6-ethyl-2-methyl-3-[4-(2-methylphenoxy)butyl]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 28692570 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 6-ethyl-2-methyl-3-[4-(2-methylphenoxy)butyl]thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCc1cc2c(=O)n(CCCCOc3ccccc3C)c(C)nc2s1 |
| InChI | InChI=1S/C20H24N2O2S/c1-4-16-13-17-19(25-16)21-15(3)22(20(17)23)11-7-8-12-24-18-10-6-5-9-14(18)2/h5-6,9-10,13H,4,7-8,11-12H2,1-3H3 |
| InChIKey | RFLQUZNMZQZHRG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|