C21H27N3O5 — CID 2869281
2-[2-(adamantane-1-carbonyl)hydrazinyl]-N-(2,5-dimethoxyphenyl)-2-oxoacetamide (PubChem CID 2869281) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-[2-(adamantane-1-carbonyl)hydrazinyl]-N-(2,5-dimethoxyphenyl)-2-oxoacetamide.
| Compound Name | 2-[2-(adamantane-1-carbonyl)hydrazinyl]-N-(2,5-dimethoxyphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 2869281 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 2-[2-(adamantane-1-carbonyl)hydrazinyl]-N-(2,5-dimethoxyphenyl)-2-oxoacetamide |
| SMILES | COc1ccc(OC)c(NC(=O)C(=O)NNC(=O)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C21H27N3O5/c1-28-15-3-4-17(29-2)16(8-15)22-18(25)19(26)23-24-20(27)21-9-12-5-13(10-21)7-14(6-12)11-21/h3-4,8,12-14H,5-7,9-11H2,1-2H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | QBTVZZLUGKEYOR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|