C20H21FN2O2S2 — CID 28698001
ethyl (2S,4S)-3-(benzylcarbamothioyl)-2-(4-fluorophenyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 28698001) has the molecular formula C20H21FN2O2S2 and a molecular weight of 404.53 g/mol. Its IUPAC name is ethyl (2S,4S)-3-(benzylcarbamothioyl)-2-(4-fluorophenyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | ethyl (2S,4S)-3-(benzylcarbamothioyl)-2-(4-fluorophenyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 28698001 |
| Molecular Formula | C20H21FN2O2S2 |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | ethyl (2S,4S)-3-(benzylcarbamothioyl)-2-(4-fluorophenyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | CCOC(=O)[C@H]1CS[C@@H](c2ccc(F)cc2)N1C(=S)NCc1ccccc1 |
| InChI | InChI=1S/C20H21FN2O2S2/c1-2-25-19(24)17-13-27-18(15-8-10-16(21)11-9-15)23(17)20(26)22-12-14-6-4-3-5-7-14/h3-11,17-18H,2,12-13H2,1H3,(H,22,26)/t17-,18+/m1/s1 |
| InChIKey | LECKUFKEYMANPM-MSOLQXFVSA-N |
| XLogP | 3.88 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|