C17H23N3O4S — CID 46481619
ethyl 4-[2-(benzylcarbamoylamino)-2-oxoethyl]thiomorpholine-3-carboxylate (PubChem CID 46481619) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is ethyl 4-[2-(benzylcarbamoylamino)-2-oxoethyl]thiomorpholine-3-carboxylate.
| Compound Name | ethyl 4-[2-(benzylcarbamoylamino)-2-oxoethyl]thiomorpholine-3-carboxylate |
|---|---|
| PubChem CID | 46481619 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | ethyl 4-[2-(benzylcarbamoylamino)-2-oxoethyl]thiomorpholine-3-carboxylate |
| SMILES | CCOC(=O)C1CSCCN1CC(=O)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H23N3O4S/c1-2-24-16(22)14-12-25-9-8-20(14)11-15(21)19-17(23)18-10-13-6-4-3-5-7-13/h3-7,14H,2,8-12H2,1H3,(H2,18,19,21,23) |
| InChIKey | CJBZXVSAMZQADI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |