C23H22ClN3O4S — CID 28698452
ethyl 4-[(4R)-4-[2-(3-chloroanilino)-2-oxoethyl]-5-oxo-3-prop-2-enyl-2-sulfanylideneimidazolidin-1-yl]benzoate (PubChem CID 28698452) has the molecular formula C23H22ClN3O4S and a molecular weight of 471.97 g/mol. Its IUPAC name is ethyl 4-[(4R)-4-[2-(3-chloroanilino)-2-oxoethyl]-5-oxo-3-prop-2-enyl-2-sulfanylideneimidazolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[(4R)-4-[2-(3-chloroanilino)-2-oxoethyl]-5-oxo-3-prop-2-enyl-2-sulfanylideneimidazolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 28698452 |
| Molecular Formula | C23H22ClN3O4S |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | ethyl 4-[(4R)-4-[2-(3-chloroanilino)-2-oxoethyl]-5-oxo-3-prop-2-enyl-2-sulfanylideneimidazolidin-1-yl]benzoate |
| SMILES | C=CCN1C(=S)N(c2ccc(C(=O)OCC)cc2)C(=O)[C@H]1CC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H22ClN3O4S/c1-3-12-26-19(14-20(28)25-17-7-5-6-16(24)13-17)21(29)27(23(26)32)18-10-8-15(9-11-18)22(30)31-4-2/h3,5-11,13,19H,1,4,12,14H2,2H3,(H,25,28)/t19-/m1/s1 |
| InChIKey | LZEXNAZTPDUVBR-LJQANCHMSA-N |
| XLogP | 4.03 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|