C21H19Cl2N3O3S — CID 2951957
2-[1-(3-chloro-4-methoxyphenyl)-5-oxo-3-prop-2-enyl-2-sulfanylideneimidazolidin-4-yl]-N-(3-chlorophenyl)acetamide (PubChem CID 2951957) has the molecular formula C21H19Cl2N3O3S and a molecular weight of 464.37 g/mol. Its IUPAC name is 2-[1-(3-chloro-4-methoxyphenyl)-5-oxo-3-prop-2-enyl-2-sulfanylideneimidazolidin-4-yl]-N-(3-chlorophenyl)acetamide.
| Compound Name | 2-[1-(3-chloro-4-methoxyphenyl)-5-oxo-3-prop-2-enyl-2-sulfanylideneimidazolidin-4-yl]-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 2951957 |
| Molecular Formula | C21H19Cl2N3O3S |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | 2-[1-(3-chloro-4-methoxyphenyl)-5-oxo-3-prop-2-enyl-2-sulfanylideneimidazolidin-4-yl]-N-(3-chlorophenyl)acetamide |
| SMILES | C=CCN1C(=S)N(c2ccc(OC)c(Cl)c2)C(=O)C1CC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H19Cl2N3O3S/c1-3-9-25-17(12-19(27)24-14-6-4-5-13(22)10-14)20(28)26(21(25)30)15-7-8-18(29-2)16(23)11-15/h3-8,10-11,17H,1,9,12H2,2H3,(H,24,27) |
| InChIKey | RBURMMWTPKTVLO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|