C14H22ClNO — CID 2871809
N-benzyl-2,2-dimethyloxan-4-amine;hydrochloride (PubChem CID 2871809) has the molecular formula C14H22ClNO and a molecular weight of 255.79 g/mol. Its IUPAC name is N-benzyl-2,2-dimethyloxan-4-amine;hydrochloride.
| Compound Name | N-benzyl-2,2-dimethyloxan-4-amine;hydrochloride |
|---|---|
| PubChem CID | 2871809 |
| Molecular Formula | C14H22ClNO |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-benzyl-2,2-dimethyloxan-4-amine;hydrochloride |
| SMILES | CC1(C)CC(NCc2ccccc2)CCO1.Cl |
| InChI | InChI=1S/C14H21NO.ClH/c1-14(2)10-13(8-9-16-14)15-11-12-6-4-3-5-7-12;/h3-7,13,15H,8-11H2,1-2H3;1H |
| InChIKey | AIFCVTWNKTUNND-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |