C14H21NO — CID 2871810
N-benzyl-2,2-dimethyloxan-4-amine (PubChem CID 2871810) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is N-benzyl-2,2-dimethyloxan-4-amine.
| Compound Name | N-benzyl-2,2-dimethyloxan-4-amine |
|---|---|
| PubChem CID | 2871810 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | N-benzyl-2,2-dimethyloxan-4-amine |
| SMILES | CC1(C)CC(NCc2ccccc2)CCO1 |
| InChI | InChI=1S/C14H21NO/c1-14(2)10-13(8-9-16-14)15-11-12-6-4-3-5-7-12/h3-7,13,15H,8-11H2,1-2H3 |
| InChIKey | MSWLMOCCTHCSBL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |