C23H13Cl2N3O2 — CID 2873316
2-cyano-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-quinolin-5-ylprop-2-enamide (PubChem CID 2873316) has the molecular formula C23H13Cl2N3O2 and a molecular weight of 434.28 g/mol. Its IUPAC name is 2-cyano-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-quinolin-5-ylprop-2-enamide.
| Compound Name | 2-cyano-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-quinolin-5-ylprop-2-enamide |
|---|---|
| PubChem CID | 2873316 |
| Molecular Formula | C23H13Cl2N3O2 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | 2-cyano-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-quinolin-5-ylprop-2-enamide |
| SMILES | N#CC(=Cc1ccc(-c2cccc(Cl)c2Cl)o1)C(=O)Nc1cccc2ncccc12 |
| InChI | InChI=1S/C23H13Cl2N3O2/c24-18-6-1-4-17(22(18)25)21-10-9-15(30-21)12-14(13-26)23(29)28-20-8-2-7-19-16(20)5-3-11-27-19/h1-12H,(H,28,29) |
| InChIKey | RFDDNINWPNXLOG-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|