C10H17N3O4S — CID 28740496
4-[2-(dimethylazaniumyl)ethylsulfamoyl]-1-methylpyrrole-2-carboxylate (PubChem CID 28740496) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is 4-[2-(dimethylazaniumyl)ethylsulfamoyl]-1-methylpyrrole-2-carboxylate.
| Compound Name | 4-[2-(dimethylazaniumyl)ethylsulfamoyl]-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 28740496 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 4-[2-(dimethylazaniumyl)ethylsulfamoyl]-1-methylpyrrole-2-carboxylate |
| SMILES | Cn1cc(S(=O)(=O)NCC[NH+](C)C)cc1C(=O)[O-] |
| InChI | InChI=1S/C10H17N3O4S/c1-12(2)5-4-11-18(16,17)8-6-9(10(14)15)13(3)7-8/h6-7,11H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | MLLXBUBNUCETDE-UHFFFAOYSA-N |
| XLogP | -3.19 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | -3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |