C19H15Cl2NO4S — CID 28748220
(2S)-3-(2-chlorophenyl)-2-[(3R)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid (PubChem CID 28748220) has the molecular formula C19H15Cl2NO4S and a molecular weight of 424.31 g/mol. Its IUPAC name is (2S)-3-(2-chlorophenyl)-2-[(3R)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid.
| Compound Name | (2S)-3-(2-chlorophenyl)-2-[(3R)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 28748220 |
| Molecular Formula | C19H15Cl2NO4S |
| Molecular Weight | 424.31 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | (2S)-3-(2-chlorophenyl)-2-[(3R)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccccc1Cl)S[C@@H]1CC(=O)N(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C19H15Cl2NO4S/c20-12-5-7-13(8-6-12)22-17(23)10-15(18(22)24)27-16(19(25)26)9-11-3-1-2-4-14(11)21/h1-8,15-16H,9-10H2,(H,25,26)/t15-,16+/m1/s1 |
| InChIKey | RTEUITFUJNGHCD-CVEARBPZSA-N |
| XLogP | 4.05 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|