C17H17N5O2S — CID 28754139
2-[[5-(4-tert-butylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine (PubChem CID 28754139) has the molecular formula C17H17N5O2S and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-[[5-(4-tert-butylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine.
| Compound Name | 2-[[5-(4-tert-butylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine |
|---|---|
| PubChem CID | 28754139 |
| Molecular Formula | C17H17N5O2S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-[[5-(4-tert-butylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine |
| SMILES | CC(C)(C)c1ccc(-c2nc(Sc3ccc([N+](=O)[O-])cn3)n[nH]2)cc1 |
| InChI | InChI=1S/C17H17N5O2S/c1-17(2,3)12-6-4-11(5-7-12)15-19-16(21-20-15)25-14-9-8-13(10-18-14)22(23)24/h4-10H,1-3H3,(H,19,20,21) |
| InChIKey | UCLZLQCVBKXRAT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|