C12H20N2O — CID 28772430
N'-(4-ethoxyphenyl)-N'-ethylethane-1,2-diamine (PubChem CID 28772430) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is N'-(4-ethoxyphenyl)-N'-ethylethane-1,2-diamine.
| Compound Name | N'-(4-ethoxyphenyl)-N'-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 28772430 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | N'-(4-ethoxyphenyl)-N'-ethylethane-1,2-diamine |
| SMILES | CCOc1ccc(N(CC)CCN)cc1 |
| InChI | InChI=1S/C12H20N2O/c1-3-14(10-9-13)11-5-7-12(8-6-11)15-4-2/h5-8H,3-4,9-10,13H2,1-2H3 |
| InChIKey | OHUWPQPYOMWCHC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|