C21H21F3N4O4 — CID 2877297
(2,3-difluorophenyl)-[4-(4-fluoro-5-morpholin-4-yl-2-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 2877297) has the molecular formula C21H21F3N4O4 and a molecular weight of 450.42 g/mol. Its IUPAC name is (2,3-difluorophenyl)-[4-(4-fluoro-5-morpholin-4-yl-2-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | (2,3-difluorophenyl)-[4-(4-fluoro-5-morpholin-4-yl-2-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 2877297 |
| Molecular Formula | C21H21F3N4O4 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | (2,3-difluorophenyl)-[4-(4-fluoro-5-morpholin-4-yl-2-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cccc(F)c1F)N1CCN(c2cc(N3CCOCC3)c(F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H21F3N4O4/c22-15-3-1-2-14(20(15)24)21(29)27-6-4-25(5-7-27)18-13-17(26-8-10-32-11-9-26)16(23)12-19(18)28(30)31/h1-3,12-13H,4-11H2 |
| InChIKey | WCGSTJYUGFBZQI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 79.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|