C22H22ClF3N4O4 — CID 2881713
(2-chloro-5,6-difluoro-3-methylphenyl)-[4-(4-fluoro-5-morpholin-4-yl-2-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 2881713) has the molecular formula C22H22ClF3N4O4 and a molecular weight of 498.89 g/mol. Its IUPAC name is (2-chloro-5,6-difluoro-3-methylphenyl)-[4-(4-fluoro-5-morpholin-4-yl-2-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | (2-chloro-5,6-difluoro-3-methylphenyl)-[4-(4-fluoro-5-morpholin-4-yl-2-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 2881713 |
| Molecular Formula | C22H22ClF3N4O4 |
| Molecular Weight | 498.89 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | (2-chloro-5,6-difluoro-3-methylphenyl)-[4-(4-fluoro-5-morpholin-4-yl-2-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | Cc1cc(F)c(F)c(C(=O)N2CCN(c3cc(N4CCOCC4)c(F)cc3[N+](=O)[O-])CC2)c1Cl |
| InChI | InChI=1S/C22H22ClF3N4O4/c1-13-10-15(25)21(26)19(20(13)23)22(31)29-4-2-27(3-5-29)17-12-16(28-6-8-34-9-7-28)14(24)11-18(17)30(32)33/h10-12H,2-9H2,1H3 |
| InChIKey | QOYLRHAJOMMWGI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 79.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.89 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|