C7H9N3O3S — CID 28777698
3-[(4-methylthiadiazole-5-carbonyl)amino]propanoic acid (PubChem CID 28777698) has the molecular formula C7H9N3O3S and a molecular weight of 215.23 g/mol. Its IUPAC name is 3-[(4-methylthiadiazole-5-carbonyl)amino]propanoic acid.
| Compound Name | 3-[(4-methylthiadiazole-5-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 28777698 |
| Molecular Formula | C7H9N3O3S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 3-[(4-methylthiadiazole-5-carbonyl)amino]propanoic acid |
| SMILES | Cc1nnsc1C(=O)NCCC(=O)O |
| InChI | InChI=1S/C7H9N3O3S/c1-4-6(14-10-9-4)7(13)8-3-2-5(11)12/h2-3H2,1H3,(H,8,13)(H,11,12) |
| InChIKey | FSEXSXBAEHVXGC-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |