C14H17N3S — CID 2878061
N-(butan-2-ylideneamino)-5-methyl-4-phenyl-1,3-thiazol-2-amine (PubChem CID 2878061) has the molecular formula C14H17N3S and a molecular weight of 259.38 g/mol. Its IUPAC name is N-(butan-2-ylideneamino)-5-methyl-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-(butan-2-ylideneamino)-5-methyl-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2878061 |
| Molecular Formula | C14H17N3S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | N-(butan-2-ylideneamino)-5-methyl-4-phenyl-1,3-thiazol-2-amine |
| SMILES | CCC(C)=NNc1nc(-c2ccccc2)c(C)s1 |
| InChI | InChI=1S/C14H17N3S/c1-4-10(2)16-17-14-15-13(11(3)18-14)12-8-6-5-7-9-12/h5-9H,4H2,1-3H3,(H,15,17) |
| InChIKey | RDXYJJXWOKJWSR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|