C14H20N8O — CID 28784640
[1-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]triazol-4-yl]methylurea (PubChem CID 28784640) has the molecular formula C14H20N8O and a molecular weight of 316.37 g/mol. Its IUPAC name is [1-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]triazol-4-yl]methylurea.
| Compound Name | [1-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]triazol-4-yl]methylurea |
|---|---|
| PubChem CID | 28784640 |
| Molecular Formula | C14H20N8O |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | [1-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]triazol-4-yl]methylurea |
| SMILES | NC(=O)NCc1cn(CC2CCN(c3cnccn3)CC2)nn1 |
| InChI | InChI=1S/C14H20N8O/c15-14(23)18-7-12-10-22(20-19-12)9-11-1-5-21(6-2-11)13-8-16-3-4-17-13/h3-4,8,10-11H,1-2,5-7,9H2,(H3,15,18,23) |
| InChIKey | BOFNGEXZDKHXIN-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 114.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |