C27H22N4O4 — CID 2880243
2-[2-(5-methoxy-1,2-dimethylindol-3-yl)ethenyl]-3-(4-nitrophenyl)quinazolin-4-one (PubChem CID 2880243) has the molecular formula C27H22N4O4 and a molecular weight of 466.50 g/mol. Its IUPAC name is 2-[2-(5-methoxy-1,2-dimethylindol-3-yl)ethenyl]-3-(4-nitrophenyl)quinazolin-4-one.
| Compound Name | 2-[2-(5-methoxy-1,2-dimethylindol-3-yl)ethenyl]-3-(4-nitrophenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 2880243 |
| Molecular Formula | C27H22N4O4 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 2-[2-(5-methoxy-1,2-dimethylindol-3-yl)ethenyl]-3-(4-nitrophenyl)quinazolin-4-one |
| SMILES | COc1ccc2c(c1)c(C=Cc1nc3ccccc3c(=O)n1-c1ccc([N+](=O)[O-])cc1)c(C)n2C |
| InChI | InChI=1S/C27H22N4O4/c1-17-21(23-16-20(35-3)12-14-25(23)29(17)2)13-15-26-28-24-7-5-4-6-22(24)27(32)30(26)18-8-10-19(11-9-18)31(33)34/h4-16H,1-3H3 |
| InChIKey | RMDQHEFRILNCBC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 92.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|