C24H20N4O6 — CID 6435970
3-(5-nitro-2-pyridinyl)-2-[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]quinazolin-4-one (PubChem CID 6435970) has the molecular formula C24H20N4O6 and a molecular weight of 460.45 g/mol. Its IUPAC name is 3-(5-nitro-2-pyridinyl)-2-[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]quinazolin-4-one.
| Compound Name | 3-(5-nitro-2-pyridinyl)-2-[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 6435970 |
| Molecular Formula | C24H20N4O6 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 3-(5-nitro-2-pyridinyl)-2-[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]quinazolin-4-one |
| SMILES | COc1cc(OC)c(/C=C/c2nc3ccccc3c(=O)n2-c2ccc([N+](=O)[O-])cn2)c(OC)c1 |
| InChI | InChI=1S/C24H20N4O6/c1-32-16-12-20(33-2)18(21(13-16)34-3)9-11-23-26-19-7-5-4-6-17(19)24(29)27(23)22-10-8-15(14-25-22)28(30)31/h4-14H,1-3H3/b11-9+ |
| InChIKey | LHZJPDNFXXMMPR-PKNBQFBNSA-N |
| XLogP | 3.89 |
| TPSA | 118.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|