C15H18N2O4 — CID 28805835
ethyl 4-amino-5-(4-hydroxy-3-methoxyphenyl)-2-methyl-1H-pyrrole-3-carboxylate (PubChem CID 28805835) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is ethyl 4-amino-5-(4-hydroxy-3-methoxyphenyl)-2-methyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 4-amino-5-(4-hydroxy-3-methoxyphenyl)-2-methyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 28805835 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | ethyl 4-amino-5-(4-hydroxy-3-methoxyphenyl)-2-methyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(-c2ccc(O)c(OC)c2)c1N |
| InChI | InChI=1S/C15H18N2O4/c1-4-21-15(19)12-8(2)17-14(13(12)16)9-5-6-10(18)11(7-9)20-3/h5-7,17-18H,4,16H2,1-3H3 |
| InChIKey | CBDXNGUKVCXBFA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 97.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |