C21H19BrN2O3S — CID 2880748
6-bromo-3-[2-[4-(dimethylamino)phenyl]-1,3-thiazolidine-3-carbonyl]chromen-2-one (PubChem CID 2880748) has the molecular formula C21H19BrN2O3S and a molecular weight of 459.37 g/mol. Its IUPAC name is 6-bromo-3-[2-[4-(dimethylamino)phenyl]-1,3-thiazolidine-3-carbonyl]chromen-2-one.
| Compound Name | 6-bromo-3-[2-[4-(dimethylamino)phenyl]-1,3-thiazolidine-3-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 2880748 |
| Molecular Formula | C21H19BrN2O3S |
| Molecular Weight | 459.37 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | 6-bromo-3-[2-[4-(dimethylamino)phenyl]-1,3-thiazolidine-3-carbonyl]chromen-2-one |
| SMILES | CN(C)c1ccc(C2SCCN2C(=O)c2cc3cc(Br)ccc3oc2=O)cc1 |
| InChI | InChI=1S/C21H19BrN2O3S/c1-23(2)16-6-3-13(4-7-16)20-24(9-10-28-20)19(25)17-12-14-11-15(22)5-8-18(14)27-21(17)26/h3-8,11-12,20H,9-10H2,1-2H3 |
| InChIKey | LLPKMSAUNXLXHE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|