5-(2-chlorophenoxy)furan-2-carboxylic acid

C11H7ClO4 — CID 28814727

IUPAC5-(2-chlorophenoxy)furan-2-carboxylic acid
SMILESO=C(O)c1ccc(Oc2ccccc2Cl)o1
InChIInChI=1S/C11H7ClO4/c12-7-3-1-2-4-8(7)15-10-6-5-9(16-10)11(13)14/h1-6H,(H,13,14)
InChIKeyQXSYYBMKPOCACX-UHFFFAOYSA-N
MW238.63 g/mol
LogP3.42
Rot. Bonds3

About 5-(2-chlorophenoxy)furan-2-carboxylic acid

5-(2-chlorophenoxy)furan-2-carboxylic acid (PubChem CID 28814727) has the molecular formula C11H7ClO4 and a molecular weight of 238.63 g/mol. Its IUPAC name is 5-(2-chlorophenoxy)furan-2-carboxylic acid.

Molecular Properties

Compound Name5-(2-chlorophenoxy)furan-2-carboxylic acid
PubChem CID28814727
Molecular FormulaC11H7ClO4
Molecular Weight238.63 g/mol
Exact Mass238.00
IUPAC Name5-(2-chlorophenoxy)furan-2-carboxylic acid
SMILESO=C(O)c1ccc(Oc2ccccc2Cl)o1
InChIInChI=1S/C11H7ClO4/c12-7-3-1-2-4-8(7)15-10-6-5-9(16-10)11(13)14/h1-6H,(H,13,14)
InChIKeyQXSYYBMKPOCACX-UHFFFAOYSA-N
XLogP3.42
TPSA59.67 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.63
LogP ≤ 53.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-(2-chlorophenoxy)furan-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

5-[2-(hydroxymethyl)phenoxy]furan-2-carboxylic acid
CID 55244838
5-[2-chloro-3-(trifluoromethyl)phenoxy]furan-2-carboxylic acid
CID 46779209
3-[5-(2-chlorophenoxy)furan-2-yl]propanoic acid
CID 28814865
N-butyl-5-(2-chlorophenoxy)furan-2-carboxamide
CID 91938782
5-(2-chlorophenoxy)-N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)furan-2-carboxamide
CID 18180839
5-(2-chlorophenoxy)-N-[[4-(pyrrolidin-1-ylmethyl)oxan-4-yl]methyl]furan-2-carboxamide
CID 91957682
5-(2-chlorophenyl)furan-2-carboxylic acid
CID 784625
furan-2,5-dicarboxylic acid;indigane
CID 174700126
5-(5-fluoro-2-nitrophenoxy)furan-2-carboxylic acid
CID 55049940
5-(3,5-dimethylphenoxy)furan-2-carboxylic acid
CID 28814724
5-[2-(2-chlorophenyl)acetyl]furan-2-carboxylic acid
CID 106946683
5-(2-phenoxyethoxy)furan-2-carboxylic acid
CID 62205472

Frequently Asked Questions

What is the IUPAC name of 5-(2-chlorophenoxy)furan-2-carboxylic acid?
The IUPAC name of 5-(2-chlorophenoxy)furan-2-carboxylic acid (CID 28814727) is 5-(2-chlorophenoxy)furan-2-carboxylic acid.
What is the SMILES notation for 5-(2-chlorophenoxy)furan-2-carboxylic acid?
The canonical SMILES for 5-(2-chlorophenoxy)furan-2-carboxylic acid is O=C(O)c1ccc(Oc2ccccc2Cl)o1.
What is the InChIKey of 5-(2-chlorophenoxy)furan-2-carboxylic acid?
The InChIKey is QXSYYBMKPOCACX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7ClO4/c12-7-3-1-2-4-8(7)15-10-6-5-9(16-10)11(13)14/h1-6H,(H,13,14).
What are the key properties of 5-(2-chlorophenoxy)furan-2-carboxylic acid?
5-(2-chlorophenoxy)furan-2-carboxylic acid has a molecular weight of 238.63 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chlorophenoxy)furan-2-carboxylic acid is sourced from PubChem (CID 28814727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).