C6H5F4N — CID 28820244
2-[(1R)-2,2,3,3-tetrafluorocyclobutyl]acetonitrile (PubChem CID 28820244) has the molecular formula C6H5F4N and a molecular weight of 167.10 g/mol. Its IUPAC name is 2-[(1R)-2,2,3,3-tetrafluorocyclobutyl]acetonitrile.
| Compound Name | 2-[(1R)-2,2,3,3-tetrafluorocyclobutyl]acetonitrile |
|---|---|
| PubChem CID | 28820244 |
| Molecular Formula | C6H5F4N |
| Molecular Weight | 167.10 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | 2-[(1R)-2,2,3,3-tetrafluorocyclobutyl]acetonitrile |
| SMILES | N#CC[C@@H]1CC(F)(F)C1(F)F |
| InChI | InChI=1S/C6H5F4N/c7-5(8)3-4(1-2-11)6(5,9)10/h4H,1,3H2/t4-/m1/s1 |
| InChIKey | BJHVLMUITSVYQT-SCSAIBSYSA-N |
| XLogP | 2.19 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.10 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|