C12H20BrNO — CID 14758047
2-[(1S,2R)-2-[(2R)-3-bromo-2-hydroxypropyl]-2-methylcyclohexyl]acetonitrile (PubChem CID 14758047) has the molecular formula C12H20BrNO and a molecular weight of 274.20 g/mol. Its IUPAC name is 2-[(1S,2R)-2-[(2R)-3-bromo-2-hydroxypropyl]-2-methylcyclohexyl]acetonitrile.
| Compound Name | 2-[(1S,2R)-2-[(2R)-3-bromo-2-hydroxypropyl]-2-methylcyclohexyl]acetonitrile |
|---|---|
| PubChem CID | 14758047 |
| Molecular Formula | C12H20BrNO |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-[(1S,2R)-2-[(2R)-3-bromo-2-hydroxypropyl]-2-methylcyclohexyl]acetonitrile |
| SMILES | C[C@]1(C[C@@H](O)CBr)CCCC[C@H]1CC#N |
| InChI | InChI=1S/C12H20BrNO/c1-12(8-11(15)9-13)6-3-2-4-10(12)5-7-14/h10-11,15H,2-6,8-9H2,1H3/t10-,11+,12+/m0/s1 |
| InChIKey | FKADMYRLEITAAU-QJPTWQEYSA-N |
| XLogP | 3.24 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|