C17H24N6O2 — CID 2883645
N,N-bis(2-methylpropyl)-2-nitro-4-(1,2,4-triazol-4-yliminomethyl)aniline (PubChem CID 2883645) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is N,N-bis(2-methylpropyl)-2-nitro-4-(1,2,4-triazol-4-yliminomethyl)aniline.
| Compound Name | N,N-bis(2-methylpropyl)-2-nitro-4-(1,2,4-triazol-4-yliminomethyl)aniline |
|---|---|
| PubChem CID | 2883645 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | N,N-bis(2-methylpropyl)-2-nitro-4-(1,2,4-triazol-4-yliminomethyl)aniline |
| SMILES | CC(C)CN(CC(C)C)c1ccc(C=Nn2cnnc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H24N6O2/c1-13(2)9-21(10-14(3)4)16-6-5-15(7-17(16)23(24)25)8-20-22-11-18-19-12-22/h5-8,11-14H,9-10H2,1-4H3 |
| InChIKey | OPBUFPQEQSYUAJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 89.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|