C18H21N7O — CID 2883795
1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine (PubChem CID 2883795) has the molecular formula C18H21N7O and a molecular weight of 351.41 g/mol. Its IUPAC name is 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine.
| Compound Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine |
|---|---|
| PubChem CID | 2883795 |
| Molecular Formula | C18H21N7O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine |
| SMILES | Cc1cc(C)nc(N=C(N)Nc2c(C)n(C)n(-c3ccccc3)c2=O)n1 |
| InChI | InChI=1S/C18H21N7O/c1-11-10-12(2)21-18(20-11)23-17(19)22-15-13(3)24(4)25(16(15)26)14-8-6-5-7-9-14/h5-10H,1-4H3,(H3,19,20,21,22,23) |
| InChIKey | VKYWLQVXPUGWBP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|