C19H13BrClNO — CID 2884320
6-bromo-4-(4-chlorophenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one (PubChem CID 2884320) has the molecular formula C19H13BrClNO and a molecular weight of 386.68 g/mol. Its IUPAC name is 6-bromo-4-(4-chlorophenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one.
| Compound Name | 6-bromo-4-(4-chlorophenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one |
|---|---|
| PubChem CID | 2884320 |
| Molecular Formula | C19H13BrClNO |
| Molecular Weight | 386.68 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | 6-bromo-4-(4-chlorophenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one |
| SMILES | O=C1CC(c2ccc(Cl)cc2)c2cc(Br)c3ccccc3c2N1 |
| InChI | InChI=1S/C19H13BrClNO/c20-17-9-16-15(11-5-7-12(21)8-6-11)10-18(23)22-19(16)14-4-2-1-3-13(14)17/h1-9,15H,10H2,(H,22,23) |
| InChIKey | XESOEHWJIGWKHF-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.68 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |