C30H32FNO6 — CID 28851600
[(2R)-oxolan-2-yl]methyl (4R,7S)-4-(2,5-dimethoxyphenyl)-7-(4-fluorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 28851600) has the molecular formula C30H32FNO6 and a molecular weight of 521.59 g/mol. Its IUPAC name is [(2R)-oxolan-2-yl]methyl (4R,7S)-4-(2,5-dimethoxyphenyl)-7-(4-fluorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | [(2R)-oxolan-2-yl]methyl (4R,7S)-4-(2,5-dimethoxyphenyl)-7-(4-fluorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 28851600 |
| Molecular Formula | C30H32FNO6 |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | [(2R)-oxolan-2-yl]methyl (4R,7S)-4-(2,5-dimethoxyphenyl)-7-(4-fluorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc(OC)c([C@H]2C(C(=O)OC[C@H]3CCCO3)=C(C)NC3=C2C(=O)C[C@@H](c2ccc(F)cc2)C3)c1 |
| InChI | InChI=1S/C30H32FNO6/c1-17-27(30(34)38-16-22-5-4-12-37-22)28(23-15-21(35-2)10-11-26(23)36-3)29-24(32-17)13-19(14-25(29)33)18-6-8-20(31)9-7-18/h6-11,15,19,22,28,32H,4-5,12-14,16H2,1-3H3/t19-,22+,28-/m0/s1 |
| InChIKey | BDKZTGMDFCJXSS-AZCYMXHYSA-N |
| XLogP | 4.93 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |