C29H29FN2O6 — CID 51706889
[(2S)-oxolan-2-yl]methyl (4R,7S)-7-(4-fluorophenyl)-2-methyl-4-(4-methyl-3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 51706889) has the molecular formula C29H29FN2O6 and a molecular weight of 520.56 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl (4R,7S)-7-(4-fluorophenyl)-2-methyl-4-(4-methyl-3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | [(2S)-oxolan-2-yl]methyl (4R,7S)-7-(4-fluorophenyl)-2-methyl-4-(4-methyl-3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 51706889 |
| Molecular Formula | C29H29FN2O6 |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl (4R,7S)-7-(4-fluorophenyl)-2-methyl-4-(4-methyl-3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CC1=C(C(=O)OC[C@@H]2CCCO2)[C@H](c2ccc(C)c([N+](=O)[O-])c2)C2=C(C[C@H](c3ccc(F)cc3)CC2=O)N1 |
| InChI | InChI=1S/C29H29FN2O6/c1-16-5-6-19(13-24(16)32(35)36)27-26(29(34)38-15-22-4-3-11-37-22)17(2)31-23-12-20(14-25(33)28(23)27)18-7-9-21(30)10-8-18/h5-10,13,20,22,27,31H,3-4,11-12,14-15H2,1-2H3/t20-,22-,27-/m0/s1 |
| InChIKey | JQWOXANMODTRAS-CLHVYKLBSA-N |
| XLogP | 5.13 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|