C30H32N2O7 — CID 94854836
[(2S)-oxolan-2-yl]methyl (4S,7R)-7-(4-ethoxyphenyl)-2-methyl-4-(4-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 94854836) has the molecular formula C30H32N2O7 and a molecular weight of 532.59 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl (4S,7R)-7-(4-ethoxyphenyl)-2-methyl-4-(4-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | [(2S)-oxolan-2-yl]methyl (4S,7R)-7-(4-ethoxyphenyl)-2-methyl-4-(4-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 94854836 |
| Molecular Formula | C30H32N2O7 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl (4S,7R)-7-(4-ethoxyphenyl)-2-methyl-4-(4-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CCOc1ccc([C@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)OC[C@@H]2CCCO2)[C@H]3c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C30H32N2O7/c1-3-37-23-12-8-19(9-13-23)21-15-25-29(26(33)16-21)28(20-6-10-22(11-7-20)32(35)36)27(18(2)31-25)30(34)39-17-24-5-4-14-38-24/h6-13,21,24,28,31H,3-5,14-17H2,1-2H3/t21-,24+,28-/m1/s1 |
| InChIKey | CXMQPDCTRXYJQU-RASJMTDNSA-N |
| XLogP | 5.08 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|