C20H17ClN2O6S — CID 2887559
N-(4-chloro-7,7-dimethyl-9-oxo-6,8-dihydrodibenzofuran-2-yl)-3-nitrobenzenesulfonamide (PubChem CID 2887559) has the molecular formula C20H17ClN2O6S and a molecular weight of 448.88 g/mol. Its IUPAC name is N-(4-chloro-7,7-dimethyl-9-oxo-6,8-dihydrodibenzofuran-2-yl)-3-nitrobenzenesulfonamide.
| Compound Name | N-(4-chloro-7,7-dimethyl-9-oxo-6,8-dihydrodibenzofuran-2-yl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 2887559 |
| Molecular Formula | C20H17ClN2O6S |
| Molecular Weight | 448.88 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | N-(4-chloro-7,7-dimethyl-9-oxo-6,8-dihydrodibenzofuran-2-yl)-3-nitrobenzenesulfonamide |
| SMILES | CC1(C)CC(=O)c2c(oc3c(Cl)cc(NS(=O)(=O)c4cccc([N+](=O)[O-])c4)cc23)C1 |
| InChI | InChI=1S/C20H17ClN2O6S/c1-20(2)9-16(24)18-14-6-11(7-15(21)19(14)29-17(18)10-20)22-30(27,28)13-5-3-4-12(8-13)23(25)26/h3-8,22H,9-10H2,1-2H3 |
| InChIKey | IFFZOBNOQXBYGV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.88 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|