C18H14Cl2N2O5S — CID 4990147
2-chloro-N-(4-chloro-6,7,8,9-tetrahydrodibenzofuran-2-yl)-5-nitrobenzenesulfonamide (PubChem CID 4990147) has the molecular formula C18H14Cl2N2O5S and a molecular weight of 441.29 g/mol. Its IUPAC name is 2-chloro-N-(4-chloro-6,7,8,9-tetrahydrodibenzofuran-2-yl)-5-nitrobenzenesulfonamide.
| Compound Name | 2-chloro-N-(4-chloro-6,7,8,9-tetrahydrodibenzofuran-2-yl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 4990147 |
| Molecular Formula | C18H14Cl2N2O5S |
| Molecular Weight | 441.29 g/mol |
| Exact Mass | 440.00 |
| IUPAC Name | 2-chloro-N-(4-chloro-6,7,8,9-tetrahydrodibenzofuran-2-yl)-5-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(S(=O)(=O)Nc2cc(Cl)c3oc4c(c3c2)CCCC4)c1 |
| InChI | InChI=1S/C18H14Cl2N2O5S/c19-14-6-5-11(22(23)24)9-17(14)28(25,26)21-10-7-13-12-3-1-2-4-16(12)27-18(13)15(20)8-10/h5-9,21H,1-4H2 |
| InChIKey | OQCGAMXVLGLHOD-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.29 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|