C19H15ClN2O7S — CID 2946507
N-(4-chloro-9-oxo-7,8-dihydro-6H-dibenzofuran-2-yl)-4-methoxy-3-nitrobenzenesulfonamide (PubChem CID 2946507) has the molecular formula C19H15ClN2O7S and a molecular weight of 450.86 g/mol. Its IUPAC name is N-(4-chloro-9-oxo-7,8-dihydro-6H-dibenzofuran-2-yl)-4-methoxy-3-nitrobenzenesulfonamide.
| Compound Name | N-(4-chloro-9-oxo-7,8-dihydro-6H-dibenzofuran-2-yl)-4-methoxy-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 2946507 |
| Molecular Formula | C19H15ClN2O7S |
| Molecular Weight | 450.86 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | N-(4-chloro-9-oxo-7,8-dihydro-6H-dibenzofuran-2-yl)-4-methoxy-3-nitrobenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cc(Cl)c3oc4c(c3c2)C(=O)CCC4)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H15ClN2O7S/c1-28-16-6-5-11(9-14(16)22(24)25)30(26,27)21-10-7-12-18-15(23)3-2-4-17(18)29-19(12)13(20)8-10/h5-9,21H,2-4H2,1H3 |
| InChIKey | XRHVPAVWCKLQLK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 128.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.86 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|