C15H12ClNO6S2 — CID 7730197
N-(7-chloro-2-oxo-1,3-benzoxathiol-5-yl)-3,4-dimethoxybenzenesulfonamide (PubChem CID 7730197) has the molecular formula C15H12ClNO6S2 and a molecular weight of 401.85 g/mol. Its IUPAC name is N-(7-chloro-2-oxo-1,3-benzoxathiol-5-yl)-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-(7-chloro-2-oxo-1,3-benzoxathiol-5-yl)-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 7730197 |
| Molecular Formula | C15H12ClNO6S2 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | N-(7-chloro-2-oxo-1,3-benzoxathiol-5-yl)-3,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cc(Cl)c3oc(=O)sc3c2)cc1OC |
| InChI | InChI=1S/C15H12ClNO6S2/c1-21-11-4-3-9(7-12(11)22-2)25(19,20)17-8-5-10(16)14-13(6-8)24-15(18)23-14/h3-7,17H,1-2H3 |
| InChIKey | XGCIDBYZGHKFLQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|