C11H12N2O4S2 — CID 28890638
2-methoxyethyl 5-methyl-4-oxo-2-sulfanylidene-1H-thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 28890638) has the molecular formula C11H12N2O4S2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-methoxyethyl 5-methyl-4-oxo-2-sulfanylidene-1H-thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | 2-methoxyethyl 5-methyl-4-oxo-2-sulfanylidene-1H-thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 28890638 |
| Molecular Formula | C11H12N2O4S2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 2-methoxyethyl 5-methyl-4-oxo-2-sulfanylidene-1H-thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | COCCOC(=O)c1sc2[nH]c(=S)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C11H12N2O4S2/c1-5-6-8(14)12-11(18)13-9(6)19-7(5)10(15)17-4-3-16-2/h3-4H2,1-2H3,(H2,12,13,14,18) |
| InChIKey | TYVWNWSAISGMMK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|