C23H19F3N6O3S — CID 2889942
2-(4-methylphenyl)-7-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 2889942) has the molecular formula C23H19F3N6O3S and a molecular weight of 516.51 g/mol. Its IUPAC name is 2-(4-methylphenyl)-7-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 2-(4-methylphenyl)-7-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 2889942 |
| Molecular Formula | C23H19F3N6O3S |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 2-(4-methylphenyl)-7-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | Cc1ccc(-c2nn3c(=O)cc(N4CCN(c5ccc(C(F)(F)F)cc5[N+](=O)[O-])CC4)nc3s2)cc1 |
| InChI | InChI=1S/C23H19F3N6O3S/c1-14-2-4-15(5-3-14)21-28-31-20(33)13-19(27-22(31)36-21)30-10-8-29(9-11-30)17-7-6-16(23(24,25)26)12-18(17)32(34)35/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | LOFYMOWRTWNCHC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|