C20H21F3N6O3S — CID 3293810
2-butyl-7-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 3293810) has the molecular formula C20H21F3N6O3S and a molecular weight of 482.49 g/mol. Its IUPAC name is 2-butyl-7-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 2-butyl-7-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 3293810 |
| Molecular Formula | C20H21F3N6O3S |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 2-butyl-7-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CCCCc1nn2c(=O)cc(N3CCN(c4ccc(C(F)(F)F)cc4[N+](=O)[O-])CC3)nc2s1 |
| InChI | InChI=1S/C20H21F3N6O3S/c1-2-3-4-17-25-28-18(30)12-16(24-19(28)33-17)27-9-7-26(8-10-27)14-6-5-13(20(21,22)23)11-15(14)29(31)32/h5-6,11-12H,2-4,7-10H2,1H3 |
| InChIKey | RKOFSNHRZVHNJZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|