C25H18BrClN2O4S — CID 2890317
2-[[4-[2-(4-bromophenoxy)ethoxy]-3-chloro-5-methoxyphenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one (PubChem CID 2890317) has the molecular formula C25H18BrClN2O4S and a molecular weight of 557.85 g/mol. Its IUPAC name is 2-[[4-[2-(4-bromophenoxy)ethoxy]-3-chloro-5-methoxyphenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one.
| Compound Name | 2-[[4-[2-(4-bromophenoxy)ethoxy]-3-chloro-5-methoxyphenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
|---|---|
| PubChem CID | 2890317 |
| Molecular Formula | C25H18BrClN2O4S |
| Molecular Weight | 557.85 g/mol |
| Exact Mass | 555.99 |
| IUPAC Name | 2-[[4-[2-(4-bromophenoxy)ethoxy]-3-chloro-5-methoxyphenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
| SMILES | COc1cc(C=c2sc3nc4ccccc4n3c2=O)cc(Cl)c1OCCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C25H18BrClN2O4S/c1-31-21-13-15(12-18(27)23(21)33-11-10-32-17-8-6-16(26)7-9-17)14-22-24(30)29-20-5-3-2-4-19(20)28-25(29)34-22/h2-9,12-14H,10-11H2,1H3 |
| InChIKey | PXJWJXKHDHZJDZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.85 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|