C32H33ClN2O5S — CID 6112650
(2Z)-2-[[3-chloro-5-ethoxy-4-[2-(4-hexoxyphenoxy)ethoxy]phenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one (PubChem CID 6112650) has the molecular formula C32H33ClN2O5S and a molecular weight of 593.15 g/mol. Its IUPAC name is (2Z)-2-[[3-chloro-5-ethoxy-4-[2-(4-hexoxyphenoxy)ethoxy]phenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one.
| Compound Name | (2Z)-2-[[3-chloro-5-ethoxy-4-[2-(4-hexoxyphenoxy)ethoxy]phenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
|---|---|
| PubChem CID | 6112650 |
| Molecular Formula | C32H33ClN2O5S |
| Molecular Weight | 593.15 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | (2Z)-2-[[3-chloro-5-ethoxy-4-[2-(4-hexoxyphenoxy)ethoxy]phenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
| SMILES | CCCCCCOc1ccc(OCCOc2c(Cl)cc(/C=c3\sc4nc5ccccc5n4c3=O)cc2OCC)cc1 |
| InChI | InChI=1S/C32H33ClN2O5S/c1-3-5-6-9-16-38-23-12-14-24(15-13-23)39-17-18-40-30-25(33)19-22(20-28(30)37-4-2)21-29-31(36)35-27-11-8-7-10-26(27)34-32(35)41-29/h7-8,10-15,19-21H,3-6,9,16-18H2,1-2H3/b29-21- |
| InChIKey | JITHQVUFPXVFBC-ANYBSYGZSA-N |
| XLogP | 6.93 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.15 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|