2-(1-ethyl-4,5-dimethylimidazol-2-yl)sulfanylacetic acid

C9H14N2O2S — CID 28915024

IUPAC2-(1-ethyl-4,5-dimethylimidazol-2-yl)sulfanylacetic acid
SMILESCCn1c(SCC(=O)O)nc(C)c1C
InChIInChI=1S/C9H14N2O2S/c1-4-11-7(3)6(2)10-9(11)14-5-8(12)13/h4-5H2,1-3H3,(H,12,13)
InChIKeyYJBZGBNNQYSZIP-UHFFFAOYSA-N
MW214.29 g/mol
LogP1.70
Rot. Bonds4

About 2-(1-ethyl-4,5-dimethylimidazol-2-yl)sulfanylacetic acid

2-(1-ethyl-4,5-dimethylimidazol-2-yl)sulfanylacetic acid (PubChem CID 28915024) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-(1-ethyl-4,5-dimethylimidazol-2-yl)sulfanylacetic acid.

Molecular Properties

Compound Name2-(1-ethyl-4,5-dimethylimidazol-2-yl)sulfanylacetic acid
PubChem CID28915024
Molecular FormulaC9H14N2O2S
Molecular Weight214.29 g/mol
Exact Mass214.08
IUPAC Name2-(1-ethyl-4,5-dimethylimidazol-2-yl)sulfanylacetic acid
SMILESCCn1c(SCC(=O)O)nc(C)c1C
InChIInChI=1S/C9H14N2O2S/c1-4-11-7(3)6(2)10-9(11)14-5-8(12)13/h4-5H2,1-3H3,(H,12,13)
InChIKeyYJBZGBNNQYSZIP-UHFFFAOYSA-N
XLogP1.70
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.29
LogP ≤ 51.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(1-ethyl-4,5-dimethylimidazol-2-yl)sulfanylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-ethyl-4,5-dimethylimidazol-2-yl)sulfanylacetic acid?
The IUPAC name of 2-(1-ethyl-4,5-dimethylimidazol-2-yl)sulfanylacetic acid (CID 28915024) is 2-(1-ethyl-4,5-dimethylimidazol-2-yl)sulfanylacetic acid.
What is the SMILES notation for 2-(1-ethyl-4,5-dimethylimidazol-2-yl)sulfanylacetic acid?
The canonical SMILES for 2-(1-ethyl-4,5-dimethylimidazol-2-yl)sulfanylacetic acid is CCn1c(SCC(=O)O)nc(C)c1C.
What is the InChIKey of 2-(1-ethyl-4,5-dimethylimidazol-2-yl)sulfanylacetic acid?
The InChIKey is YJBZGBNNQYSZIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2S/c1-4-11-7(3)6(2)10-9(11)14-5-8(12)13/h4-5H2,1-3H3,(H,12,13).
What are the key properties of 2-(1-ethyl-4,5-dimethylimidazol-2-yl)sulfanylacetic acid?
2-(1-ethyl-4,5-dimethylimidazol-2-yl)sulfanylacetic acid has a molecular weight of 214.29 g/mol, XLogP of 1.70, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-ethyl-4,5-dimethylimidazol-2-yl)sulfanylacetic acid is sourced from PubChem (CID 28915024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).