C18H17NOS — CID 28934993
2-(1,3-benzothiazol-2-yl)-1-(2,4,6-trimethylphenyl)ethanone (PubChem CID 28934993) has the molecular formula C18H17NOS and a molecular weight of 295.41 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-1-(2,4,6-trimethylphenyl)ethanone.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-1-(2,4,6-trimethylphenyl)ethanone |
|---|---|
| PubChem CID | 28934993 |
| Molecular Formula | C18H17NOS |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-1-(2,4,6-trimethylphenyl)ethanone |
| SMILES | Cc1cc(C)c(C(=O)Cc2nc3ccccc3s2)c(C)c1 |
| InChI | InChI=1S/C18H17NOS/c1-11-8-12(2)18(13(3)9-11)15(20)10-17-19-14-6-4-5-7-16(14)21-17/h4-9H,10H2,1-3H3 |
| InChIKey | KOEIYFFTVUBNIF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |