5-(1,3-benzothiazol-2-ylmethyl)-2-methylbenzoic acid

C16H13NO2S — CID 79818498

IUPAC5-(1,3-benzothiazol-2-ylmethyl)-2-methylbenzoic acid
SMILESCc1ccc(Cc2nc3ccccc3s2)cc1C(=O)O
InChIInChI=1S/C16H13NO2S/c1-10-6-7-11(8-12(10)16(18)19)9-15-17-13-4-2-3-5-14(13)20-15/h2-8H,9H2,1H3,(H,18,19)
InChIKeyNSVDRIWQUINWAG-UHFFFAOYSA-N
MW283.35 g/mol
LogP3.89
Rot. Bonds3

About 5-(1,3-benzothiazol-2-ylmethyl)-2-methylbenzoic acid

5-(1,3-benzothiazol-2-ylmethyl)-2-methylbenzoic acid (PubChem CID 79818498) has the molecular formula C16H13NO2S and a molecular weight of 283.35 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-ylmethyl)-2-methylbenzoic acid.

Molecular Properties

Compound Name5-(1,3-benzothiazol-2-ylmethyl)-2-methylbenzoic acid
PubChem CID79818498
Molecular FormulaC16H13NO2S
Molecular Weight283.35 g/mol
Exact Mass283.07
IUPAC Name5-(1,3-benzothiazol-2-ylmethyl)-2-methylbenzoic acid
SMILESCc1ccc(Cc2nc3ccccc3s2)cc1C(=O)O
InChIInChI=1S/C16H13NO2S/c1-10-6-7-11(8-12(10)16(18)19)9-15-17-13-4-2-3-5-14(13)20-15/h2-8H,9H2,1H3,(H,18,19)
InChIKeyNSVDRIWQUINWAG-UHFFFAOYSA-N
XLogP3.89
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.35
LogP ≤ 53.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-(1,3-benzothiazol-2-ylmethyl)-2-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(1,3-benzothiazol-2-ylmethyl)-2-methylbenzoic acid?
The IUPAC name of 5-(1,3-benzothiazol-2-ylmethyl)-2-methylbenzoic acid (CID 79818498) is 5-(1,3-benzothiazol-2-ylmethyl)-2-methylbenzoic acid.
What is the SMILES notation for 5-(1,3-benzothiazol-2-ylmethyl)-2-methylbenzoic acid?
The canonical SMILES for 5-(1,3-benzothiazol-2-ylmethyl)-2-methylbenzoic acid is Cc1ccc(Cc2nc3ccccc3s2)cc1C(=O)O.
What is the InChIKey of 5-(1,3-benzothiazol-2-ylmethyl)-2-methylbenzoic acid?
The InChIKey is NSVDRIWQUINWAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO2S/c1-10-6-7-11(8-12(10)16(18)19)9-15-17-13-4-2-3-5-14(13)20-15/h2-8H,9H2,1H3,(H,18,19).
What are the key properties of 5-(1,3-benzothiazol-2-ylmethyl)-2-methylbenzoic acid?
5-(1,3-benzothiazol-2-ylmethyl)-2-methylbenzoic acid has a molecular weight of 283.35 g/mol, XLogP of 3.89, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-benzothiazol-2-ylmethyl)-2-methylbenzoic acid is sourced from PubChem (CID 79818498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).